C16H15N — CID 144591964
3,4-bis(ethenyl)-5-(4-methylphenyl)pyridine (PubChem CID 144591964) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-5-(4-methylphenyl)pyridine.
| Compound Name | 3,4-bis(ethenyl)-5-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 144591964 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3,4-bis(ethenyl)-5-(4-methylphenyl)pyridine |
| SMILES | C=Cc1cncc(-c2ccc(C)cc2)c1C=C |
| InChI | InChI=1S/C16H15N/c1-4-13-10-17-11-16(15(13)5-2)14-8-6-12(3)7-9-14/h4-11H,1-2H2,3H3 |
| InChIKey | JCWGPMABIUSGMM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |