C24H37N3O6 — CID 144592007
tert-butyl 2-[3-[[(1E)-1-hydroxyimino-1-(3-methoxyphenyl)propan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate (PubChem CID 144592007) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is tert-butyl 2-[3-[[(1E)-1-hydroxyimino-1-(3-methoxyphenyl)propan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-[[(1E)-1-hydroxyimino-1-(3-methoxyphenyl)propan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144592007 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | tert-butyl 2-[3-[[(1E)-1-hydroxyimino-1-(3-methoxyphenyl)propan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidine-1-carboxylate |
| SMILES | COc1cccc(/C(=N\O)C(C)NC(=O)C(C)C(OC)C2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H37N3O6/c1-15(21(32-7)19-12-9-13-27(19)23(29)33-24(3,4)5)22(28)25-16(2)20(26-30)17-10-8-11-18(14-17)31-6/h8,10-11,14-16,19,21,30H,9,12-13H2,1-7H3,(H,25,28)/b26-20- |
| InChIKey | NMGIVIIMEMGNOZ-QOMWVZHYSA-N |
| XLogP | 3.43 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|