About 2-ethyl-2-methyloxepane
2-ethyl-2-methyloxepane (PubChem CID 144595022) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-ethyl-2-methyloxepane.
Molecular Properties
| Compound Name | 2-ethyl-2-methyloxepane |
| PubChem CID | 144595022 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2-ethyl-2-methyloxepane |
| SMILES | CCC1(C)CCCCCO1 |
| InChI | InChI=1S/C9H18O/c1-3-9(2)7-5-4-6-8-10-9/h3-8H2,1-2H3 |
| InChIKey | ORKSFQLVNMTKRS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-2-methyloxepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-methyloxepane?
The IUPAC name of 2-ethyl-2-methyloxepane (CID 144595022) is 2-ethyl-2-methyloxepane.
What is the SMILES notation for 2-ethyl-2-methyloxepane?
The canonical SMILES for 2-ethyl-2-methyloxepane is CCC1(C)CCCCCO1.
What is the InChIKey of 2-ethyl-2-methyloxepane?
The InChIKey is ORKSFQLVNMTKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-9(2)7-5-4-6-8-10-9/h3-8H2,1-2H3.
What are the key properties of 2-ethyl-2-methyloxepane?
2-ethyl-2-methyloxepane has a molecular weight of 142.24 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-methyloxepane is sourced from PubChem (CID 144595022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).