C10H13F2N3 — CID 144598713
3-(1,1-difluoroethyl)-5-ethanimidoyl-2-methylpyridin-4-amine (PubChem CID 144598713) has the molecular formula C10H13F2N3 and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-5-ethanimidoyl-2-methylpyridin-4-amine.
| Compound Name | 3-(1,1-difluoroethyl)-5-ethanimidoyl-2-methylpyridin-4-amine |
|---|---|
| PubChem CID | 144598713 |
| Molecular Formula | C10H13F2N3 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3-(1,1-difluoroethyl)-5-ethanimidoyl-2-methylpyridin-4-amine |
| SMILES | [H]/N=C(\C)c1cnc(C)c(C(C)(F)F)c1N |
| InChI | InChI=1S/C10H13F2N3/c1-5(13)7-4-15-6(2)8(9(7)14)10(3,11)12/h4,13H,1-3H3,(H2,14,15)/b13-5+ |
| InChIKey | LLSKCJAUCZJRDC-WLRTZDKTSA-N |
| XLogP | 2.47 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|