C18H19F4N5O — CID 144599052
methyl 4-amino-6-[1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]ethenylamino]-2-(trifluoromethyl)pyridine-3-carboximidate (PubChem CID 144599052) has the molecular formula C18H19F4N5O and a molecular weight of 397.38 g/mol. Its IUPAC name is methyl 4-amino-6-[1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]ethenylamino]-2-(trifluoromethyl)pyridine-3-carboximidate.
| Compound Name | methyl 4-amino-6-[1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]ethenylamino]-2-(trifluoromethyl)pyridine-3-carboximidate |
|---|---|
| PubChem CID | 144599052 |
| Molecular Formula | C18H19F4N5O |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 4-amino-6-[1-[[(1R)-1-(4-fluorophenyl)ethyl]amino]ethenylamino]-2-(trifluoromethyl)pyridine-3-carboximidate |
| SMILES | [H]/N=C(\OC)c1c(N)cc(NC(=C)N[C@H](C)c2ccc(F)cc2)nc1C(F)(F)F |
| InChI | InChI=1S/C18H19F4N5O/c1-9(11-4-6-12(19)7-5-11)25-10(2)26-14-8-13(23)15(17(24)28-3)16(27-14)18(20,21)22/h4-9,24-25H,2H2,1,3H3,(H3,23,26,27)/b24-17-/t9-/m1/s1 |
| InChIKey | LTDBWAFFFWJJHX-AIESTTBSSA-N |
| XLogP | 4.03 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|