C11H23NO5S — CID 144599491
tert-butyl 4-hydroxypiperidine-1-carboxylate;methanesulfinic acid (PubChem CID 144599491) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is tert-butyl 4-hydroxypiperidine-1-carboxylate;methanesulfinic acid.
| Compound Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;methanesulfinic acid |
|---|---|
| PubChem CID | 144599491 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | tert-butyl 4-hydroxypiperidine-1-carboxylate;methanesulfinic acid |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)CC1.CS(=O)O |
| InChI | InChI=1S/C10H19NO3.CH4O2S/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;1-4(2)3/h8,12H,4-7H2,1-3H3;1H3,(H,2,3) |
| InChIKey | NELMULUITLZSAK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|