C55H52N2 — CID 144600911
N-[4-[4-[(9,9-dimethylfluoren-2-yl)-[(E)-hept-2-en-2-yl]amino]phenyl]phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine (PubChem CID 144600911) has the molecular formula C55H52N2 and a molecular weight of 741.03 g/mol. Its IUPAC name is N-[4-[4-[(9,9-dimethylfluoren-2-yl)-[(E)-hept-2-en-2-yl]amino]phenyl]phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine.
| Compound Name | N-[4-[4-[(9,9-dimethylfluoren-2-yl)-[(E)-hept-2-en-2-yl]amino]phenyl]phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 144600911 |
| Molecular Formula | C55H52N2 |
| Molecular Weight | 741.03 g/mol |
| Exact Mass | 740.41 |
| IUPAC Name | N-[4-[4-[(9,9-dimethylfluoren-2-yl)-[(E)-hept-2-en-2-yl]amino]phenyl]phenyl]-9,9-dimethyl-N-phenylfluoren-2-amine |
| SMILES | CCCC/C=C(\C)N(c1ccc(-c2ccc(N(c3ccccc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc2)cc1)c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C55H52N2/c1-7-8-10-17-38(2)56(44-32-34-48-46-20-13-15-22-50(46)54(3,4)52(48)36-44)42-28-24-39(25-29-42)40-26-30-43(31-27-40)57(41-18-11-9-12-19-41)45-33-35-49-47-21-14-16-23-51(47)55(5,6)53(49)37-45/h9,11-37H,7-8,10H2,1-6H3/b38-17+ |
| InChIKey | UYKMLEHRDOLXSN-OAQMXIGCSA-N |
| XLogP | 15.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.03 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|