C18H20IN3O2S — CID 144601486
tert-butyl 2-[6-(2-iodosulfanylethynyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 144601486) has the molecular formula C18H20IN3O2S and a molecular weight of 469.35 g/mol. Its IUPAC name is tert-butyl 2-[6-(2-iodosulfanylethynyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[6-(2-iodosulfanylethynyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 144601486 |
| Molecular Formula | C18H20IN3O2S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | tert-butyl 2-[6-(2-iodosulfanylethynyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1nc2ccc(C#CSI)cc2[nH]1 |
| InChI | InChI=1S/C18H20IN3O2S/c1-18(2,3)24-17(23)22-9-4-5-15(22)16-20-13-7-6-12(8-10-25-19)11-14(13)21-16/h6-7,11,15H,4-5,9H2,1-3H3,(H,20,21) |
| InChIKey | VIVMBIQPQVJVJP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|