C19H25N3O2 — CID 170985706
tert-butyl (2S)-2-(6-prop-2-enyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 170985706) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-(6-prop-2-enyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(6-prop-2-enyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170985706 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | tert-butyl (2S)-2-(6-prop-2-enyl-1H-benzimidazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=CCc1ccc2nc([C@@H]3CCCN3C(=O)OC(C)(C)C)[nH]c2c1 |
| InChI | InChI=1S/C19H25N3O2/c1-5-7-13-9-10-14-15(12-13)21-17(20-14)16-8-6-11-22(16)18(23)24-19(2,3)4/h5,9-10,12,16H,1,6-8,11H2,2-4H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | PLECLFCBRWTRHP-INIZCTEOSA-N |
| XLogP | 4.36 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|