C13H14BrN3O2 — CID 66750526
2-[6-(bromomethyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylic acid (PubChem CID 66750526) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is 2-[6-(bromomethyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-[6-(bromomethyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66750526 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[6-(bromomethyl)-1H-benzimidazol-2-yl]pyrrolidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCCC1c1nc2ccc(CBr)cc2[nH]1 |
| InChI | InChI=1S/C13H14BrN3O2/c14-7-8-3-4-9-10(6-8)16-12(15-9)11-2-1-5-17(11)13(18)19/h3-4,6,11H,1-2,5,7H2,(H,15,16)(H,18,19) |
| InChIKey | UUGMVCYIXFMOFJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|