C19H17N5 — CID 144602381
N'-[5-[2-(3-cyclopropylphenyl)-3-pyridinyl]pyrimidin-2-yl]methanimidamide (PubChem CID 144602381) has the molecular formula C19H17N5 and a molecular weight of 315.38 g/mol. Its IUPAC name is N'-[5-[2-(3-cyclopropylphenyl)-3-pyridinyl]pyrimidin-2-yl]methanimidamide.
| Compound Name | N'-[5-[2-(3-cyclopropylphenyl)-3-pyridinyl]pyrimidin-2-yl]methanimidamide |
|---|---|
| PubChem CID | 144602381 |
| Molecular Formula | C19H17N5 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | N'-[5-[2-(3-cyclopropylphenyl)-3-pyridinyl]pyrimidin-2-yl]methanimidamide |
| SMILES | N/C=N\c1ncc(-c2cccnc2-c2cccc(C3CC3)c2)cn1 |
| InChI | InChI=1S/C19H17N5/c20-12-24-19-22-10-16(11-23-19)17-5-2-8-21-18(17)15-4-1-3-14(9-15)13-6-7-13/h1-5,8-13H,6-7H2,(H2,20,22,23,24) |
| InChIKey | URRDBBWUWPMWTG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|