C17H32N2O2 — CID 144603348
cis-(1R,2S)-2-acetyl-N-[3-[butyl(methyl)amino]propyl]cyclohexane-1-carboxamide (PubChem CID 144603348) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is cis-(1R,2S)-2-acetyl-N-[3-[butyl(methyl)amino]propyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-acetyl-N-[3-[butyl(methyl)amino]propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 144603348 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | cis-(1R,2S)-2-acetyl-N-[3-[butyl(methyl)amino]propyl]cyclohexane-1-carboxamide |
| SMILES | CCCCN(C)CCCNC(=O)[C@@H]1CCCC[C@@H]1C(C)=O |
| InChI | InChI=1S/C17H32N2O2/c1-4-5-12-19(3)13-8-11-18-17(21)16-10-7-6-9-15(16)14(2)20/h15-16H,4-13H2,1-3H3,(H,18,21)/t15-,16-/m1/s1 |
| InChIKey | BTJGJHQJVJEKCQ-HZPDHXFCSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|