C24H23N3 — CID 144603581
1-[2-[3-ethyl-5-(3-methylphenyl)phenyl]-3H-benzimidazol-5-yl]ethenamine (PubChem CID 144603581) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-[2-[3-ethyl-5-(3-methylphenyl)phenyl]-3H-benzimidazol-5-yl]ethenamine.
| Compound Name | 1-[2-[3-ethyl-5-(3-methylphenyl)phenyl]-3H-benzimidazol-5-yl]ethenamine |
|---|---|
| PubChem CID | 144603581 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 1-[2-[3-ethyl-5-(3-methylphenyl)phenyl]-3H-benzimidazol-5-yl]ethenamine |
| SMILES | C=C(N)c1ccc2nc(-c3cc(CC)cc(-c4cccc(C)c4)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H23N3/c1-4-17-11-20(19-7-5-6-15(2)10-19)13-21(12-17)24-26-22-9-8-18(16(3)25)14-23(22)27-24/h5-14H,3-4,25H2,1-2H3,(H,26,27) |
| InChIKey | SFRNZJHSHHAFNM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |