C26H34O2 — CID 144603585
[(E)-2,2,5-trimethyl-5-[4-(4-methylphenyl)phenyl]hex-3-enyl] 2-methylpropanoate (PubChem CID 144603585) has the molecular formula C26H34O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is [(E)-2,2,5-trimethyl-5-[4-(4-methylphenyl)phenyl]hex-3-enyl] 2-methylpropanoate.
| Compound Name | [(E)-2,2,5-trimethyl-5-[4-(4-methylphenyl)phenyl]hex-3-enyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 144603585 |
| Molecular Formula | C26H34O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | [(E)-2,2,5-trimethyl-5-[4-(4-methylphenyl)phenyl]hex-3-enyl] 2-methylpropanoate |
| SMILES | Cc1ccc(-c2ccc(C(C)(C)/C=C/C(C)(C)COC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H34O2/c1-19(2)24(27)28-18-25(4,5)16-17-26(6,7)23-14-12-22(13-15-23)21-10-8-20(3)9-11-21/h8-17,19H,18H2,1-7H3/b17-16+ |
| InChIKey | MLKXAEWTJPWDTG-WUKNDPDISA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|