C28H41NO2 — CID 144649391
ethane;[(E)-2,2,5-trimethyl-5-[4-[4-(methylamino)phenyl]phenyl]hex-3-enyl] 2-methylpropanoate (PubChem CID 144649391) has the molecular formula C28H41NO2 and a molecular weight of 423.64 g/mol. Its IUPAC name is ethane;[(E)-2,2,5-trimethyl-5-[4-[4-(methylamino)phenyl]phenyl]hex-3-enyl] 2-methylpropanoate.
| Compound Name | ethane;[(E)-2,2,5-trimethyl-5-[4-[4-(methylamino)phenyl]phenyl]hex-3-enyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 144649391 |
| Molecular Formula | C28H41NO2 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | ethane;[(E)-2,2,5-trimethyl-5-[4-[4-(methylamino)phenyl]phenyl]hex-3-enyl] 2-methylpropanoate |
| SMILES | CC.CNc1ccc(-c2ccc(C(C)(C)/C=C/C(C)(C)COC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H35NO2.C2H6/c1-19(2)24(28)29-18-25(3,4)16-17-26(5,6)22-12-8-20(9-13-22)21-10-14-23(27-7)15-11-21;1-2/h8-17,19,27H,18H2,1-7H3;1-2H3/b17-16+; |
| InChIKey | ODHSHQJGJCNNHZ-CMBBICFISA-N |
| XLogP | 7.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|