C17H24NO2S- — CID 162430900
[(E)-2,2,5-trimethyl-5-[4-(sulfidoamino)phenyl]hex-3-enyl] acetate (PubChem CID 162430900) has the molecular formula C17H24NO2S- and a molecular weight of 306.45 g/mol. Its IUPAC name is [(E)-2,2,5-trimethyl-5-[4-(sulfidoamino)phenyl]hex-3-enyl] acetate.
| Compound Name | [(E)-2,2,5-trimethyl-5-[4-(sulfidoamino)phenyl]hex-3-enyl] acetate |
|---|---|
| PubChem CID | 162430900 |
| Molecular Formula | C17H24NO2S- |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [(E)-2,2,5-trimethyl-5-[4-(sulfidoamino)phenyl]hex-3-enyl] acetate |
| SMILES | CC(=O)OCC(C)(C)/C=C/C(C)(C)c1ccc(N[S-])cc1 |
| InChI | InChI=1S/C17H24NO2S/c1-13(19)20-12-16(2,3)10-11-17(4,5)14-6-8-15(18-21)9-7-14/h6-11,18H,12H2,1-5H3/q-1/b11-10+ |
| InChIKey | YLLPSUQADIRRNJ-ZHACJKMWSA-N |
| XLogP | 3.98 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|