C14H25NO3 — CID 144603814
(2S,3aS)-1-acetyl-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylic acid;ethane (PubChem CID 144603814) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (2S,3aS)-1-acetyl-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylic acid;ethane.
| Compound Name | (2S,3aS)-1-acetyl-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 144603814 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2S,3aS)-1-acetyl-3a-methyl-3,4,5,6,7,7a-hexahydro-2H-indole-2-carboxylic acid;ethane |
| SMILES | CC.CC(=O)N1C2CCCC[C@@]2(C)C[C@H]1C(=O)O |
| InChI | InChI=1S/C12H19NO3.C2H6/c1-8(14)13-9(11(15)16)7-12(2)6-4-3-5-10(12)13;1-2/h9-10H,3-7H2,1-2H3,(H,15,16);1-2H3/t9-,10?,12-;/m0./s1 |
| InChIKey | ZZVHIKZVHHPQJO-FMDYATEQSA-N |
| XLogP | 2.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |