1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid

C13H23NO2 — CID 79853568

IUPAC1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid
SMILESCC1(C)CCCCC1N1CCC(C(=O)O)C1
InChIInChI=1S/C13H23NO2/c1-13(2)7-4-3-5-11(13)14-8-6-10(9-14)12(15)16/h10-11H,3-9H2,1-2H3,(H,15,16)
InChIKeySJMSMZJOBNVSHW-UHFFFAOYSA-N
MW225.33 g/mol
LogP2.36
Rot. Bonds2

About 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid

1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid (PubChem CID 79853568) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid
PubChem CID79853568
Molecular FormulaC13H23NO2
Molecular Weight225.33 g/mol
Exact Mass225.17
IUPAC Name1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid
SMILESCC1(C)CCCCC1N1CCC(C(=O)O)C1
InChIInChI=1S/C13H23NO2/c1-13(2)7-4-3-5-11(13)14-8-6-10(9-14)12(15)16/h10-11H,3-9H2,1-2H3,(H,15,16)
InChIKeySJMSMZJOBNVSHW-UHFFFAOYSA-N
XLogP2.36
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.33
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid (CID 79853568) is 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid is CC1(C)CCCCC1N1CCC(C(=O)O)C1.
What is the InChIKey of 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
The InChIKey is SJMSMZJOBNVSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2/c1-13(2)7-4-3-5-11(13)14-8-6-10(9-14)12(15)16/h10-11H,3-9H2,1-2H3,(H,15,16).
What are the key properties of 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid?
1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid has a molecular weight of 225.33 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylcyclohexyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 79853568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).