C13H23NO2S — CID 79955917
1-(4,4-dimethylthian-3-yl)piperidine-3-carboxylic acid (PubChem CID 79955917) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1-(4,4-dimethylthian-3-yl)piperidine-3-carboxylic acid.
| Compound Name | 1-(4,4-dimethylthian-3-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79955917 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-(4,4-dimethylthian-3-yl)piperidine-3-carboxylic acid |
| SMILES | CC1(C)CCSCC1N1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO2S/c1-13(2)5-7-17-9-11(13)14-6-3-4-10(8-14)12(15)16/h10-11H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | GNYQQPFQJNXGNC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |