C5H14N2O4S2 — CID 14460428
N'-tert-butylmethanedisulfonamide (PubChem CID 14460428) has the molecular formula C5H14N2O4S2 and a molecular weight of 230.31 g/mol. Its IUPAC name is N'-tert-butylmethanedisulfonamide.
| Compound Name | N'-tert-butylmethanedisulfonamide |
|---|---|
| PubChem CID | 14460428 |
| Molecular Formula | C5H14N2O4S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | N'-tert-butylmethanedisulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C5H14N2O4S2/c1-5(2,3)7-13(10,11)4-12(6,8)9/h7H,4H2,1-3H3,(H2,6,8,9) |
| InChIKey | JXHPKZQHJZNCAK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |