C21H27F3O2S — CID 144605305
(2E,4E)-5-methyl-2-[(Z)-3-methylpent-2-en-2-yl]-7-[4-(trifluoromethyl)phenyl]sulfanylhepta-2,4-diene-1,3-diol (PubChem CID 144605305) has the molecular formula C21H27F3O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is (2E,4E)-5-methyl-2-[(Z)-3-methylpent-2-en-2-yl]-7-[4-(trifluoromethyl)phenyl]sulfanylhepta-2,4-diene-1,3-diol.
| Compound Name | (2E,4E)-5-methyl-2-[(Z)-3-methylpent-2-en-2-yl]-7-[4-(trifluoromethyl)phenyl]sulfanylhepta-2,4-diene-1,3-diol |
|---|---|
| PubChem CID | 144605305 |
| Molecular Formula | C21H27F3O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (2E,4E)-5-methyl-2-[(Z)-3-methylpent-2-en-2-yl]-7-[4-(trifluoromethyl)phenyl]sulfanylhepta-2,4-diene-1,3-diol |
| SMILES | CC/C(C)=C(C)\C(CO)=C(O)\C=C(/C)CCSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H27F3O2S/c1-5-15(3)16(4)19(13-25)20(26)12-14(2)10-11-27-18-8-6-17(7-9-18)21(22,23)24/h6-9,12,25-26H,5,10-11,13H2,1-4H3/b14-12+,16-15-,20-19- |
| InChIKey | MYJPEQRLPUBVNN-LHMIJKRYSA-N |
| XLogP | 6.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|