C19H25N3O2 — CID 144605403
3-[2-(cyclopropylmethylamino)cyclopropyl]benzaldehyde;N,5-dimethyl-1,2-oxazol-3-amine (PubChem CID 144605403) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-[2-(cyclopropylmethylamino)cyclopropyl]benzaldehyde;N,5-dimethyl-1,2-oxazol-3-amine.
| Compound Name | 3-[2-(cyclopropylmethylamino)cyclopropyl]benzaldehyde;N,5-dimethyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 144605403 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-[2-(cyclopropylmethylamino)cyclopropyl]benzaldehyde;N,5-dimethyl-1,2-oxazol-3-amine |
| SMILES | CNc1cc(C)on1.O=Cc1cccc(C2CC2NCC2CC2)c1 |
| InChI | InChI=1S/C14H17NO.C5H8N2O/c16-9-11-2-1-3-12(6-11)13-7-14(13)15-8-10-4-5-10;1-4-3-5(6-2)7-8-4/h1-3,6,9-10,13-15H,4-5,7-8H2;3H,1-2H3,(H,6,7) |
| InChIKey | IJLJMFIBSUIMTD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|