C23H19ClF2IN4O4- — CID 144606190
CID 144606190 (PubChem CID 144606190) has the molecular formula C23H19ClF2IN4O4- and a molecular weight of 615.78 g/mol.
| Compound Name | CID 144606190 |
|---|---|
| PubChem CID | 144606190 |
| Molecular Formula | C23H19ClF2IN4O4- |
| Molecular Weight | 615.78 g/mol |
| Exact Mass | 615.01 |
| IUPAC Name | — |
| SMILES | C=C(C)C(F)(F)c1ncn(CC2=C[I-]N=C(OC)C(CO)=C2)c(=O)c1Oc1cc(Cl)cc(C#N)c1 |
| InChI | InChI=1S/C23H19ClF2IN4O4/c1-13(2)23(25,26)20-19(35-18-6-14(9-28)5-17(24)7-18)22(33)31(12-29-20)10-15-4-16(11-32)21(34-3)30-27-8-15/h4-8,12,32H,1,10-11H2,2-3H3/q-1 |
| InChIKey | WEASPKNSWUHTRC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 109.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.78 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|