C10H20N2 — CID 144607335
3,4-dimethyl-1-propan-2-ylpyrazole;ethane (PubChem CID 144607335) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 3,4-dimethyl-1-propan-2-ylpyrazole;ethane.
| Compound Name | 3,4-dimethyl-1-propan-2-ylpyrazole;ethane |
|---|---|
| PubChem CID | 144607335 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 3,4-dimethyl-1-propan-2-ylpyrazole;ethane |
| SMILES | CC.Cc1cn(C(C)C)nc1C |
| InChI | InChI=1S/C8H14N2.C2H6/c1-6(2)10-5-7(3)8(4)9-10;1-2/h5-6H,1-4H3;1-2H3 |
| InChIKey | UJSSHZKKQQDJQW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |