C15H22N2 — CID 145058285
3,4-dimethyl-1-(1-phenylethyl)pyrazole;ethane (PubChem CID 145058285) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 3,4-dimethyl-1-(1-phenylethyl)pyrazole;ethane.
| Compound Name | 3,4-dimethyl-1-(1-phenylethyl)pyrazole;ethane |
|---|---|
| PubChem CID | 145058285 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 3,4-dimethyl-1-(1-phenylethyl)pyrazole;ethane |
| SMILES | CC.Cc1cn(C(C)c2ccccc2)nc1C |
| InChI | InChI=1S/C13H16N2.C2H6/c1-10-9-15(14-11(10)2)12(3)13-7-5-4-6-8-13;1-2/h4-9,12H,1-3H3;1-2H3 |
| InChIKey | FEITYSOBOQKCLA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |