C22H33N5O — CID 119045598
1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-[4-methyl-1-(1-phenylethyl)pyrazol-3-yl]urea (PubChem CID 119045598) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-[4-methyl-1-(1-phenylethyl)pyrazol-3-yl]urea.
| Compound Name | 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-[4-methyl-1-(1-phenylethyl)pyrazol-3-yl]urea |
|---|---|
| PubChem CID | 119045598 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1-[2-(1-ethylpiperidin-4-yl)ethyl]-3-[4-methyl-1-(1-phenylethyl)pyrazol-3-yl]urea |
| SMILES | CCN1CCC(CCNC(=O)Nc2nn(C(C)c3ccccc3)cc2C)CC1 |
| InChI | InChI=1S/C22H33N5O/c1-4-26-14-11-19(12-15-26)10-13-23-22(28)24-21-17(2)16-27(25-21)18(3)20-8-6-5-7-9-20/h5-9,16,18-19H,4,10-15H2,1-3H3,(H2,23,24,25,28) |
| InChIKey | IEULPXXMEVEZMU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |