C24H27ClF4N2O4 — CID 144607468
[1,1,1-trifluoro-3-[(3R)-3-[4-fluoro-3-(2-methoxyethoxy)phenyl]piperidin-1-yl]propan-2-yl] N-(4-chlorophenyl)carbamate (PubChem CID 144607468) has the molecular formula C24H27ClF4N2O4 and a molecular weight of 518.94 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-[(3R)-3-[4-fluoro-3-(2-methoxyethoxy)phenyl]piperidin-1-yl]propan-2-yl] N-(4-chlorophenyl)carbamate.
| Compound Name | [1,1,1-trifluoro-3-[(3R)-3-[4-fluoro-3-(2-methoxyethoxy)phenyl]piperidin-1-yl]propan-2-yl] N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 144607468 |
| Molecular Formula | C24H27ClF4N2O4 |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [1,1,1-trifluoro-3-[(3R)-3-[4-fluoro-3-(2-methoxyethoxy)phenyl]piperidin-1-yl]propan-2-yl] N-(4-chlorophenyl)carbamate |
| SMILES | COCCOc1cc([C@H]2CCCN(CC(OC(=O)Nc3ccc(Cl)cc3)C(F)(F)F)C2)ccc1F |
| InChI | InChI=1S/C24H27ClF4N2O4/c1-33-11-12-34-21-13-16(4-9-20(21)26)17-3-2-10-31(14-17)15-22(24(27,28)29)35-23(32)30-19-7-5-18(25)6-8-19/h4-9,13,17,22H,2-3,10-12,14-15H2,1H3,(H,30,32)/t17-,22?/m0/s1 |
| InChIKey | STTYRQHVTKLZFZ-LBOXEOMUSA-N |
| XLogP | 5.86 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|