C11H11Br2N — CID 144607651
3-[(2E,4E)-1,5-dibromohexa-2,4-dien-3-yl]pyridine (PubChem CID 144607651) has the molecular formula C11H11Br2N and a molecular weight of 317.02 g/mol. Its IUPAC name is 3-[(2E,4E)-1,5-dibromohexa-2,4-dien-3-yl]pyridine.
| Compound Name | 3-[(2E,4E)-1,5-dibromohexa-2,4-dien-3-yl]pyridine |
|---|---|
| PubChem CID | 144607651 |
| Molecular Formula | C11H11Br2N |
| Molecular Weight | 317.02 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | 3-[(2E,4E)-1,5-dibromohexa-2,4-dien-3-yl]pyridine |
| SMILES | C/C(Br)=C\C(=C/CBr)c1cccnc1 |
| InChI | InChI=1S/C11H11Br2N/c1-9(13)7-10(4-5-12)11-3-2-6-14-8-11/h2-4,6-8H,5H2,1H3/b9-7+,10-4+ |
| InChIKey | HMVORPCJAHXLQV-FXLUECPISA-N |
| XLogP | 4.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.02 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|