C11H19NO — CID 144608616
(2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine (PubChem CID 144608616) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine.
| Compound Name | (2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 144608616 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2Z)-N-ethyl-2-(1-methoxyethenyl)-4-methylpenta-2,4-dien-1-amine |
| SMILES | C=C(C)/C=C(/CNCC)C(=C)OC |
| InChI | InChI=1S/C11H19NO/c1-6-12-8-11(7-9(2)3)10(4)13-5/h7,12H,2,4,6,8H2,1,3,5H3/b11-7- |
| InChIKey | IXXPGFWWBPXRGS-XFFZJAGNSA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|