C35H45F4N5O2 — CID 144611157
3,3-difluoro-2-methylbut-1-ene;2-(2,6-difluorophenyl)-1-[4-[2,6-dimethyl-5-[5-[(E)-5-methyloct-3-en-3-yl]-1,3,4-oxadiazol-2-yl]pyrimidin-4-yl]piperidin-1-yl]ethanone (PubChem CID 144611157) has the molecular formula C35H45F4N5O2 and a molecular weight of 643.77 g/mol. Its IUPAC name is 3,3-difluoro-2-methylbut-1-ene;2-(2,6-difluorophenyl)-1-[4-[2,6-dimethyl-5-[5-[(E)-5-methyloct-3-en-3-yl]-1,3,4-oxadiazol-2-yl]pyrimidin-4-yl]piperidin-1-yl]ethanone.
| Compound Name | 3,3-difluoro-2-methylbut-1-ene;2-(2,6-difluorophenyl)-1-[4-[2,6-dimethyl-5-[5-[(E)-5-methyloct-3-en-3-yl]-1,3,4-oxadiazol-2-yl]pyrimidin-4-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 144611157 |
| Molecular Formula | C35H45F4N5O2 |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | 3,3-difluoro-2-methylbut-1-ene;2-(2,6-difluorophenyl)-1-[4-[2,6-dimethyl-5-[5-[(E)-5-methyloct-3-en-3-yl]-1,3,4-oxadiazol-2-yl]pyrimidin-4-yl]piperidin-1-yl]ethanone |
| SMILES | C=C(C)C(C)(F)F.CCCC(C)/C=C(\CC)c1nnc(-c2c(C)nc(C)nc2C2CCN(C(=O)Cc3c(F)cccc3F)CC2)o1 |
| InChI | InChI=1S/C30H37F2N5O2.C5H8F2/c1-6-9-18(3)16-21(7-2)29-35-36-30(39-29)27-19(4)33-20(5)34-28(27)22-12-14-37(15-13-22)26(38)17-23-24(31)10-8-11-25(23)32;1-4(2)5(3,6)7/h8,10-11,16,18,22H,6-7,9,12-15,17H2,1-5H3;1H2,2-3H3/b21-16+; |
| InChIKey | RXJYGUMCDHNWQH-JEBHESKQSA-N |
| XLogP | 8.82 |
| TPSA | 85.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|