C41H36F3N3O2 — CID 144611320
(2Z)-1-(1-methyl-2,3-dihydroindol-6-yl)-2-propylidene-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridine;prop-2-enal (PubChem CID 144611320) has the molecular formula C41H36F3N3O2 and a molecular weight of 659.75 g/mol. Its IUPAC name is (2Z)-1-(1-methyl-2,3-dihydroindol-6-yl)-2-propylidene-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridine;prop-2-enal.
| Compound Name | (2Z)-1-(1-methyl-2,3-dihydroindol-6-yl)-2-propylidene-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridine;prop-2-enal |
|---|---|
| PubChem CID | 144611320 |
| Molecular Formula | C41H36F3N3O2 |
| Molecular Weight | 659.75 g/mol |
| Exact Mass | 659.28 |
| IUPAC Name | (2Z)-1-(1-methyl-2,3-dihydroindol-6-yl)-2-propylidene-9-[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]benzo[h][1,6]naphthyridine;prop-2-enal |
| SMILES | C=CC=O.CC/C=C1/C=Cc2cnc3ccc(-c4ccc(COc5cccc(C(F)(F)F)c5)cc4)cc3c2N1c1ccc2c(c1)N(C)CC2 |
| InChI | InChI=1S/C38H32F3N3O.C3H4O/c1-3-5-31-15-13-29-23-42-35-17-14-28(20-34(35)37(29)44(31)32-16-12-27-18-19-43(2)36(27)22-32)26-10-8-25(9-11-26)24-45-33-7-4-6-30(21-33)38(39,40)41;1-2-3-4/h4-17,20-23H,3,18-19,24H2,1-2H3;2-3H,1H2/b31-5-; |
| InChIKey | YARSLLPJDHBENI-ZOJKLKRBSA-N |
| XLogP | 10.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.75 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|