C23H22N4O5 — CID 144611595
[2-[5-[5-[3-(nitrosomethyl)-4-propoxyphenyl]-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]aziridin-2-yl]methanol (PubChem CID 144611595) has the molecular formula C23H22N4O5 and a molecular weight of 434.45 g/mol. Its IUPAC name is [2-[5-[5-[3-(nitrosomethyl)-4-propoxyphenyl]-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]aziridin-2-yl]methanol.
| Compound Name | [2-[5-[5-[3-(nitrosomethyl)-4-propoxyphenyl]-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]aziridin-2-yl]methanol |
|---|---|
| PubChem CID | 144611595 |
| Molecular Formula | C23H22N4O5 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | [2-[5-[5-[3-(nitrosomethyl)-4-propoxyphenyl]-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]aziridin-2-yl]methanol |
| SMILES | CCCOc1ccc(-c2nc(-c3ccc4oc(C5(CO)CN5)cc4c3)no2)cc1CN=O |
| InChI | InChI=1S/C23H22N4O5/c1-2-7-30-18-5-4-15(9-17(18)11-25-29)22-26-21(27-32-22)14-3-6-19-16(8-14)10-20(31-19)23(13-28)12-24-23/h3-6,8-10,24,28H,2,7,11-13H2,1H3 |
| InChIKey | CFSQKBLPJJREQM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|