C41H49BrN4O7S — CID 91129188
2,5-diamino-2-[5-[5-(3-bromo-4-propoxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-5-(5-octyl-1-benzothiophen-2-yl)hexane-1,3,4,6-tetrol (PubChem CID 91129188) has the molecular formula C41H49BrN4O7S and a molecular weight of 821.83 g/mol. Its IUPAC name is 2,5-diamino-2-[5-[5-(3-bromo-4-propoxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-5-(5-octyl-1-benzothiophen-2-yl)hexane-1,3,4,6-tetrol.
| Compound Name | 2,5-diamino-2-[5-[5-(3-bromo-4-propoxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-5-(5-octyl-1-benzothiophen-2-yl)hexane-1,3,4,6-tetrol |
|---|---|
| PubChem CID | 91129188 |
| Molecular Formula | C41H49BrN4O7S |
| Molecular Weight | 821.83 g/mol |
| Exact Mass | 820.25 |
| IUPAC Name | 2,5-diamino-2-[5-[5-(3-bromo-4-propoxyphenyl)-1,2,4-oxadiazol-3-yl]-1-benzofuran-2-yl]-5-(5-octyl-1-benzothiophen-2-yl)hexane-1,3,4,6-tetrol |
| SMILES | CCCCCCCCc1ccc2sc(C(N)(CO)C(O)C(O)C(N)(CO)c3cc4cc(-c5noc(-c6ccc(OCCC)c(Br)c6)n5)ccc4o3)cc2c1 |
| InChI | InChI=1S/C41H49BrN4O7S/c1-3-5-6-7-8-9-10-25-11-16-33-29(18-25)22-35(54-33)41(44,24-48)37(50)36(49)40(43,23-47)34-21-28-19-26(12-14-31(28)52-34)38-45-39(53-46-38)27-13-15-32(30(42)20-27)51-17-4-2/h11-16,18-22,36-37,47-50H,3-10,17,23-24,43-44H2,1-2H3 |
| InChIKey | NJKVOEQVLSZARG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 194.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.83 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|