C46H48 — CID 144614091
9-[1-[2-cyclopropyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]-1-phenylpropan-2-yl]-5,7,7-trimethyl-3,4-dihydrobenzo[c]fluorene (PubChem CID 144614091) has the molecular formula C46H48 and a molecular weight of 600.89 g/mol. Its IUPAC name is 9-[1-[2-cyclopropyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]-1-phenylpropan-2-yl]-5,7,7-trimethyl-3,4-dihydrobenzo[c]fluorene.
| Compound Name | 9-[1-[2-cyclopropyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]-1-phenylpropan-2-yl]-5,7,7-trimethyl-3,4-dihydrobenzo[c]fluorene |
|---|---|
| PubChem CID | 144614091 |
| Molecular Formula | C46H48 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | 9-[1-[2-cyclopropyl-3-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]phenyl]-1-phenylpropan-2-yl]-5,7,7-trimethyl-3,4-dihydrobenzo[c]fluorene |
| SMILES | C=C/C(C)=C(\C=C/C)c1cccc(C(c2ccccc2)C(C)c2ccc3c(c2)C(C)(C)c2cc(C)c4c(c2-3)C=CCC4)c1C1CC1 |
| InChI | InChI=1S/C46H48/c1-8-16-35(29(3)9-2)37-21-15-22-40(44(37)33-23-24-33)43(32-17-11-10-12-18-32)31(5)34-25-26-39-41(28-34)46(6,7)42-27-30(4)36-19-13-14-20-38(36)45(39)42/h8-12,14-18,20-22,25-28,31,33,43H,2,13,19,23-24H2,1,3-7H3/b16-8-,35-29+ |
| InChIKey | XFBDURMRIDWROX-BBVHYKJHSA-N |
| XLogP | 12.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|