C59H60 — CID 144613482
7,7-dimethyl-9-[3-[3-methyl-4-[(2Z,4Z)-5-methylocta-2,4-dien-4-yl]phenyl]butan-2-yl]-5-(7,7,9-trimethylbenzo[c]fluoren-5-yl)benzo[c]fluorene (PubChem CID 144613482) has the molecular formula C59H60 and a molecular weight of 769.13 g/mol. Its IUPAC name is 7,7-dimethyl-9-[3-[3-methyl-4-[(2Z,4Z)-5-methylocta-2,4-dien-4-yl]phenyl]butan-2-yl]-5-(7,7,9-trimethylbenzo[c]fluoren-5-yl)benzo[c]fluorene.
| Compound Name | 7,7-dimethyl-9-[3-[3-methyl-4-[(2Z,4Z)-5-methylocta-2,4-dien-4-yl]phenyl]butan-2-yl]-5-(7,7,9-trimethylbenzo[c]fluoren-5-yl)benzo[c]fluorene |
|---|---|
| PubChem CID | 144613482 |
| Molecular Formula | C59H60 |
| Molecular Weight | 769.13 g/mol |
| Exact Mass | 768.47 |
| IUPAC Name | 7,7-dimethyl-9-[3-[3-methyl-4-[(2Z,4Z)-5-methylocta-2,4-dien-4-yl]phenyl]butan-2-yl]-5-(7,7,9-trimethylbenzo[c]fluoren-5-yl)benzo[c]fluorene |
| SMILES | C/C=C\C(=C(/C)CCC)c1ccc(C(C)C(C)c2ccc3c(c2)C(C)(C)c2cc(-c4cc5c(c6ccccc46)-c4ccc(C)cc4C5(C)C)c4ccccc4c2-3)cc1C |
| InChI | InChI=1S/C59H60/c1-12-18-36(4)42(19-13-2)43-28-25-40(31-37(43)5)38(6)39(7)41-26-29-49-53(32-41)59(10,11)55-34-51(45-21-15-17-23-47(45)57(49)55)50-33-54-56(46-22-16-14-20-44(46)50)48-27-24-35(3)30-52(48)58(54,8)9/h13-17,19-34,38-39H,12,18H2,1-11H3/b19-13-,42-36- |
| InChIKey | MKEYDDFOMKRYRN-LRLZDPNOSA-N |
| XLogP | 16.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.13 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|