C38H39N — CID 123296863
N-[3-(7,7-dimethyl-5-phenylbenzo[g]fluoren-9-yl)pentan-3-yl]-2,4-dimethylaniline (PubChem CID 123296863) has the molecular formula C38H39N and a molecular weight of 509.74 g/mol. Its IUPAC name is N-[3-(7,7-dimethyl-5-phenylbenzo[g]fluoren-9-yl)pentan-3-yl]-2,4-dimethylaniline.
| Compound Name | N-[3-(7,7-dimethyl-5-phenylbenzo[g]fluoren-9-yl)pentan-3-yl]-2,4-dimethylaniline |
|---|---|
| PubChem CID | 123296863 |
| Molecular Formula | C38H39N |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | N-[3-(7,7-dimethyl-5-phenylbenzo[g]fluoren-9-yl)pentan-3-yl]-2,4-dimethylaniline |
| SMILES | CCC(CC)(Nc1ccc(C)cc1C)c1ccc2c(c1)C(C)(C)c1cc(-c3ccccc3)c3ccccc3c1-2 |
| InChI | InChI=1S/C38H39N/c1-7-38(8-2,39-35-21-18-25(3)22-26(35)4)28-19-20-31-33(23-28)37(5,6)34-24-32(27-14-10-9-11-15-27)29-16-12-13-17-30(29)36(31)34/h9-24,39H,7-8H2,1-6H3 |
| InChIKey | OHORMRYBEPOFFY-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |