C12H19NO2S — CID 14461470
N-(2,2-diethoxyethyl)-1-thiophen-2-ylethanimine (PubChem CID 14461470) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-thiophen-2-ylethanimine.
| Compound Name | N-(2,2-diethoxyethyl)-1-thiophen-2-ylethanimine |
|---|---|
| PubChem CID | 14461470 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-thiophen-2-ylethanimine |
| SMILES | CCOC(C/N=C(\C)c1cccs1)OCC |
| InChI | InChI=1S/C12H19NO2S/c1-4-14-12(15-5-2)9-13-10(3)11-7-6-8-16-11/h6-8,12H,4-5,9H2,1-3H3/b13-10+ |
| InChIKey | GJRCMOJDVLFQTF-JLHYYAGUSA-N |
| XLogP | 2.96 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|