C10H16O2S2 — CID 12623867
2-(2,2-diethoxyethylsulfanyl)thiophene (PubChem CID 12623867) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(2,2-diethoxyethylsulfanyl)thiophene.
| Compound Name | 2-(2,2-diethoxyethylsulfanyl)thiophene |
|---|---|
| PubChem CID | 12623867 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-(2,2-diethoxyethylsulfanyl)thiophene |
| SMILES | CCOC(CSc1cccs1)OCC |
| InChI | InChI=1S/C10H16O2S2/c1-3-11-9(12-4-2)8-14-10-6-5-7-13-10/h5-7,9H,3-4,8H2,1-2H3 |
| InChIKey | GQYYZRGMNKLHSK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|