C14H17NO2S2 — CID 64615696
1-(2,4-dimethoxyphenyl)-2-thiophen-2-ylsulfanylethanamine (PubChem CID 64615696) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-thiophen-2-ylsulfanylethanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-thiophen-2-ylsulfanylethanamine |
|---|---|
| PubChem CID | 64615696 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-thiophen-2-ylsulfanylethanamine |
| SMILES | COc1ccc(C(N)CSc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C14H17NO2S2/c1-16-10-5-6-11(13(8-10)17-2)12(15)9-19-14-4-3-7-18-14/h3-8,12H,9,15H2,1-2H3 |
| InChIKey | UFPXXZVOUGEWHL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |