C12H20O3S — CID 63630148
2-(3,3-diethoxypropoxymethyl)thiophene (PubChem CID 63630148) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 2-(3,3-diethoxypropoxymethyl)thiophene.
| Compound Name | 2-(3,3-diethoxypropoxymethyl)thiophene |
|---|---|
| PubChem CID | 63630148 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-(3,3-diethoxypropoxymethyl)thiophene |
| SMILES | CCOC(CCOCc1cccs1)OCC |
| InChI | InChI=1S/C12H20O3S/c1-3-14-12(15-4-2)7-8-13-10-11-6-5-9-16-11/h5-6,9,12H,3-4,7-8,10H2,1-2H3 |
| InChIKey | APIDMDBPFHZFNN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|