About N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide
N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide (PubChem CID 144616248) has the molecular formula C17H23N3O2
and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide.
Molecular Properties
| Compound Name | N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide |
| PubChem CID | 144616248 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide |
| SMILES | CC(=O)/N=C(\N)c1ccccc1C(=O)N1CC(C)CC[C@H]1C |
| InChI | InChI=1S/C17H23N3O2/c1-11-8-9-12(2)20(10-11)17(22)15-7-5-4-6-14(15)16(18)19-13(3)21/h4-7,11-12H,8-10H2,1-3H3,(H2,18,19,21)/t11?,12-/m1/s1 |
| InChIKey | RVWYDSWWJCJQEJ-PIJUOVFKSA-N |
| XLogP | 2.20 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide?
The IUPAC name of N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide (CID 144616248) is N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide.
What is the SMILES notation for N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide?
The canonical SMILES for N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide is CC(=O)/N=C(\N)c1ccccc1C(=O)N1CC(C)CC[C@H]1C.
What is the InChIKey of N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide?
The InChIKey is RVWYDSWWJCJQEJ-PIJUOVFKSA-N. The full InChI is InChI=1S/C17H23N3O2/c1-11-8-9-12(2)20(10-11)17(22)15-7-5-4-6-14(15)16(18)19-13(3)21/h4-7,11-12H,8-10H2,1-3H3,(H2,18,19,21)/t11?,12-/m1/s1.
What are the key properties of N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide?
N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide has a molecular weight of 301.39 g/mol, XLogP of 2.20, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide is sourced from PubChem (CID 144616248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).