C17H23N3O2 — CID 144616248
N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide (PubChem CID 144616248) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide.
| Compound Name | N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide |
|---|---|
| PubChem CID | 144616248 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[amino-[2-[(2R)-2,5-dimethylpiperidine-1-carbonyl]phenyl]methylidene]acetamide |
| SMILES | CC(=O)/N=C(\N)c1ccccc1C(=O)N1CC(C)CC[C@H]1C |
| InChI | InChI=1S/C17H23N3O2/c1-11-8-9-12(2)20(10-11)17(22)15-7-5-4-6-14(15)16(18)19-13(3)21/h4-7,11-12H,8-10H2,1-3H3,(H2,18,19,21)/t11?,12-/m1/s1 |
| InChIKey | RVWYDSWWJCJQEJ-PIJUOVFKSA-N |
| XLogP | 2.20 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|