C28H41NO8 — CID 144618167
2-[(6R)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-5-hydroxy-4-methylideneoxan-2-yl]acetic acid (PubChem CID 144618167) has the molecular formula C28H41NO8 and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-[(6R)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-5-hydroxy-4-methylideneoxan-2-yl]acetic acid.
| Compound Name | 2-[(6R)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-5-hydroxy-4-methylideneoxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 144618167 |
| Molecular Formula | C28H41NO8 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.28 |
| IUPAC Name | 2-[(6R)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-5-[[(Z,4S)-4-acetyloxypent-2-enoyl]amino]-3,6-dimethyloxan-2-yl]-3-methylpenta-1,3-dienyl]-5-hydroxy-4-methylideneoxan-2-yl]acetic acid |
| SMILES | C=C1CC(CC(=O)O)O[C@H](/C=C/C(C)=C/C[C@@H]2O[C@H](C)[C@H](NC(=O)/C=C\[C@H](C)OC(C)=O)C[C@@H]2C)C1O |
| InChI | InChI=1S/C28H41NO8/c1-16(8-11-25-28(34)18(3)13-22(37-25)15-27(32)33)7-10-24-17(2)14-23(20(5)36-24)29-26(31)12-9-19(4)35-21(6)30/h7-9,11-12,17,19-20,22-25,28,34H,3,10,13-15H2,1-2,4-6H3,(H,29,31)(H,32,33)/b11-8+,12-9-,16-7+/t17-,19-,20+,22?,23+,24-,25+,28?/m0/s1 |
| InChIKey | PLEGVOTUAFLKRN-GZLDBUKASA-N |
| XLogP | 3.23 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|