C16H18N2O3 — CID 144619719
1-[(2S,4R)-4-(6-methoxyisoquinolin-1-yl)oxypyrrolidin-2-yl]ethanone (PubChem CID 144619719) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[(2S,4R)-4-(6-methoxyisoquinolin-1-yl)oxypyrrolidin-2-yl]ethanone.
| Compound Name | 1-[(2S,4R)-4-(6-methoxyisoquinolin-1-yl)oxypyrrolidin-2-yl]ethanone |
|---|---|
| PubChem CID | 144619719 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-[(2S,4R)-4-(6-methoxyisoquinolin-1-yl)oxypyrrolidin-2-yl]ethanone |
| SMILES | COc1ccc2c(O[C@H]3CN[C@H](C(C)=O)C3)nccc2c1 |
| InChI | InChI=1S/C16H18N2O3/c1-10(19)15-8-13(9-18-15)21-16-14-4-3-12(20-2)7-11(14)5-6-17-16/h3-7,13,15,18H,8-9H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | QTWWWRSAXMNNGW-HIFRSBDPSA-N |
| XLogP | 1.94 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |