C18H28ClNO2 — CID 144619806
tert-butyl N-(5-chloro-2-methylphenyl)-N-(2-methylprop-2-enyl)carbamate;ethane (PubChem CID 144619806) has the molecular formula C18H28ClNO2 and a molecular weight of 325.88 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-2-methylphenyl)-N-(2-methylprop-2-enyl)carbamate;ethane.
| Compound Name | tert-butyl N-(5-chloro-2-methylphenyl)-N-(2-methylprop-2-enyl)carbamate;ethane |
|---|---|
| PubChem CID | 144619806 |
| Molecular Formula | C18H28ClNO2 |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl N-(5-chloro-2-methylphenyl)-N-(2-methylprop-2-enyl)carbamate;ethane |
| SMILES | C=C(C)CN(C(=O)OC(C)(C)C)c1cc(Cl)ccc1C.CC |
| InChI | InChI=1S/C16H22ClNO2.C2H6/c1-11(2)10-18(15(19)20-16(4,5)6)14-9-13(17)8-7-12(14)3;1-2/h7-9H,1,10H2,2-6H3;1-2H3 |
| InChIKey | IEMRNCFQOIMCRI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|