C11H14ClN — CID 155402625
5-chloro-N,2-dimethyl-N-prop-1-en-2-ylaniline (PubChem CID 155402625) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 5-chloro-N,2-dimethyl-N-prop-1-en-2-ylaniline.
| Compound Name | 5-chloro-N,2-dimethyl-N-prop-1-en-2-ylaniline |
|---|---|
| PubChem CID | 155402625 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 5-chloro-N,2-dimethyl-N-prop-1-en-2-ylaniline |
| SMILES | C=C(C)N(C)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C11H14ClN/c1-8(2)13(4)11-7-10(12)6-5-9(11)3/h5-7H,1H2,2-4H3 |
| InChIKey | HYKWQMCXXHSVRG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |