C10H12Cl2O — CID 174808009
acetyl chloride;4-chloro-1,2-dimethylbenzene (PubChem CID 174808009) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is acetyl chloride;4-chloro-1,2-dimethylbenzene.
| Compound Name | acetyl chloride;4-chloro-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 174808009 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | acetyl chloride;4-chloro-1,2-dimethylbenzene |
| SMILES | CC(=O)Cl.Cc1ccc(Cl)cc1C |
| InChI | InChI=1S/C8H9Cl.C2H3ClO/c1-6-3-4-8(9)5-7(6)2;1-2(3)4/h3-5H,1-2H3;1H3 |
| InChIKey | GGPNKUJPYTYBJU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|