C24H21F3N2O3S — CID 144620267
1-ethyl-6,7-dimethoxy-4-[[6-(trifluoromethylsulfanyloxy)quinolin-3-yl]methyl]isoquinoline (PubChem CID 144620267) has the molecular formula C24H21F3N2O3S and a molecular weight of 474.50 g/mol. Its IUPAC name is 1-ethyl-6,7-dimethoxy-4-[[6-(trifluoromethylsulfanyloxy)quinolin-3-yl]methyl]isoquinoline.
| Compound Name | 1-ethyl-6,7-dimethoxy-4-[[6-(trifluoromethylsulfanyloxy)quinolin-3-yl]methyl]isoquinoline |
|---|---|
| PubChem CID | 144620267 |
| Molecular Formula | C24H21F3N2O3S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-ethyl-6,7-dimethoxy-4-[[6-(trifluoromethylsulfanyloxy)quinolin-3-yl]methyl]isoquinoline |
| SMILES | CCc1ncc(Cc2cnc3ccc(OSC(F)(F)F)cc3c2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C24H21F3N2O3S/c1-4-20-19-11-23(31-3)22(30-2)10-18(19)16(13-29-20)8-14-7-15-9-17(32-33-24(25,26)27)5-6-21(15)28-12-14/h5-7,9-13H,4,8H2,1-3H3 |
| InChIKey | ATRWCAFHYQHUPG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|