About 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde
4-(1,2,6-thiadiazinan-2-yl)benzaldehyde (PubChem CID 144620943) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde |
| PubChem CID | 144620943 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CCCNS2)cc1 |
| InChI | InChI=1S/C10H12N2OS/c13-8-9-2-4-10(5-3-9)12-7-1-6-11-14-12/h2-5,8,11H,1,6-7H2 |
| InChIKey | UKUCWIZUOICDMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde?
The IUPAC name of 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde (CID 144620943) is 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde.
What is the SMILES notation for 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde?
The canonical SMILES for 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde is O=Cc1ccc(N2CCCNS2)cc1.
What is the InChIKey of 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde?
The InChIKey is UKUCWIZUOICDMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c13-8-9-2-4-10(5-3-9)12-7-1-6-11-14-12/h2-5,8,11H,1,6-7H2.
What are the key properties of 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde?
4-(1,2,6-thiadiazinan-2-yl)benzaldehyde has a molecular weight of 208.29 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde is sourced from PubChem (CID 144620943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).