C10H12N2OS — CID 144620943
4-(1,2,6-thiadiazinan-2-yl)benzaldehyde (PubChem CID 144620943) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde.
| Compound Name | 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde |
|---|---|
| PubChem CID | 144620943 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-(1,2,6-thiadiazinan-2-yl)benzaldehyde |
| SMILES | O=Cc1ccc(N2CCCNS2)cc1 |
| InChI | InChI=1S/C10H12N2OS/c13-8-9-2-4-10(5-3-9)12-7-1-6-11-14-12/h2-5,8,11H,1,6-7H2 |
| InChIKey | UKUCWIZUOICDMR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|