C18H21ClFN3OS — CID 144620981
N-[4-chloro-3-(methylamino)phenyl]-4-[ethyl(ethylsulfanyl)amino]-2-fluorobenzamide (PubChem CID 144620981) has the molecular formula C18H21ClFN3OS and a molecular weight of 381.90 g/mol. Its IUPAC name is N-[4-chloro-3-(methylamino)phenyl]-4-[ethyl(ethylsulfanyl)amino]-2-fluorobenzamide.
| Compound Name | N-[4-chloro-3-(methylamino)phenyl]-4-[ethyl(ethylsulfanyl)amino]-2-fluorobenzamide |
|---|---|
| PubChem CID | 144620981 |
| Molecular Formula | C18H21ClFN3OS |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | N-[4-chloro-3-(methylamino)phenyl]-4-[ethyl(ethylsulfanyl)amino]-2-fluorobenzamide |
| SMILES | CCSN(CC)c1ccc(C(=O)Nc2ccc(Cl)c(NC)c2)c(F)c1 |
| InChI | InChI=1S/C18H21ClFN3OS/c1-4-23(25-5-2)13-7-8-14(16(20)11-13)18(24)22-12-6-9-15(19)17(10-12)21-3/h6-11,21H,4-5H2,1-3H3,(H,22,24) |
| InChIKey | POPYSSJNYSHXTM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|