C29H33N3O3S — CID 144621072
N,4-dimethyl-3-quinolin-2-ylaniline;ethane;4-(3-oxo-1,3,4-oxathiazinan-4-yl)benzaldehyde (PubChem CID 144621072) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is N,4-dimethyl-3-quinolin-2-ylaniline;ethane;4-(3-oxo-1,3,4-oxathiazinan-4-yl)benzaldehyde.
| Compound Name | N,4-dimethyl-3-quinolin-2-ylaniline;ethane;4-(3-oxo-1,3,4-oxathiazinan-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 144621072 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | N,4-dimethyl-3-quinolin-2-ylaniline;ethane;4-(3-oxo-1,3,4-oxathiazinan-4-yl)benzaldehyde |
| SMILES | CC.CNc1ccc(C)c(-c2ccc3ccccc3n2)c1.O=Cc1ccc(N2CCOCS2=O)cc1 |
| InChI | InChI=1S/C17H16N2.C10H11NO3S.C2H6/c1-12-7-9-14(18-2)11-15(12)17-10-8-13-5-3-4-6-16(13)19-17;12-7-9-1-3-10(4-2-9)11-5-6-14-8-15(11)13;1-2/h3-11,18H,1-2H3;1-4,7H,5-6,8H2;1-2H3 |
| InChIKey | RLZAUKUYVXUTNX-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|